C26H32ClF2N3O3 — CID 54574047
4-amino-5-chloro-N-[[1-[6-(3,4-difluorophenyl)-6-oxohexyl]piperidin-4-yl]methyl]-2-methoxybenzamide (PubChem CID 54574047) has the molecular formula C26H32ClF2N3O3 and a molecular weight of 508.01 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[1-[6-(3,4-difluorophenyl)-6-oxohexyl]piperidin-4-yl]methyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[[1-[6-(3,4-difluorophenyl)-6-oxohexyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 54574047 |
| Molecular Formula | C26H32ClF2N3O3 |
| Molecular Weight | 508.01 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 4-amino-5-chloro-N-[[1-[6-(3,4-difluorophenyl)-6-oxohexyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCCC(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C26H32ClF2N3O3/c1-35-25-15-23(30)20(27)14-19(25)26(34)31-16-17-8-11-32(12-9-17)10-4-2-3-5-24(33)18-6-7-21(28)22(29)13-18/h6-7,13-15,17H,2-5,8-12,16,30H2,1H3,(H,31,34) |
| InChIKey | ZZHWJEYRYGQFQZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.01 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|