C23H28Cl3N3O3 — CID 67367923
4-amino-5-chloro-N-[[1-[3-(2,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-yl]methyl]-2-methoxybenzamide (PubChem CID 67367923) has the molecular formula C23H28Cl3N3O3 and a molecular weight of 500.85 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[1-[3-(2,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-yl]methyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[[1-[3-(2,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 67367923 |
| Molecular Formula | C23H28Cl3N3O3 |
| Molecular Weight | 500.85 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 4-amino-5-chloro-N-[[1-[3-(2,4-dichlorophenyl)-3-hydroxypropyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCC(O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C23H28Cl3N3O3/c1-32-22-12-20(27)19(26)11-17(22)23(31)28-13-14-4-7-29(8-5-14)9-6-21(30)16-3-2-15(24)10-18(16)25/h2-3,10-12,14,21,30H,4-9,13,27H2,1H3,(H,28,31) |
| InChIKey | KZQKGOPTHIZURJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.85 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|