C25H34ClN3O5S — CID 57271360
4-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]-1-(4-methoxyphenyl)butane-2-sulfinic acid (PubChem CID 57271360) has the molecular formula C25H34ClN3O5S and a molecular weight of 524.08 g/mol. Its IUPAC name is 4-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]-1-(4-methoxyphenyl)butane-2-sulfinic acid.
| Compound Name | 4-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]-1-(4-methoxyphenyl)butane-2-sulfinic acid |
|---|---|
| PubChem CID | 57271360 |
| Molecular Formula | C25H34ClN3O5S |
| Molecular Weight | 524.08 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 4-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]-1-(4-methoxyphenyl)butane-2-sulfinic acid |
| SMILES | COc1ccc(CC(CCN2CCC(CNC(=O)c3cc(Cl)c(N)cc3OC)CC2)S(=O)O)cc1 |
| InChI | InChI=1S/C25H34ClN3O5S/c1-33-19-5-3-17(4-6-19)13-20(35(31)32)9-12-29-10-7-18(8-11-29)16-28-25(30)21-14-22(26)23(27)15-24(21)34-2/h3-6,14-15,18,20H,7-13,16,27H2,1-2H3,(H,28,30)(H,31,32) |
| InChIKey | INSYCJZLWZLYFZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.08 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|