C18H25BClN3O3 — CID 59280146
CID 59280146 (PubChem CID 59280146) has the molecular formula C18H25BClN3O3 and a molecular weight of 377.68 g/mol.
| Compound Name | CID 59280146 |
|---|---|
| PubChem CID | 59280146 |
| Molecular Formula | C18H25BClN3O3 |
| Molecular Weight | 377.68 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)CCN1CCC(CNC(=O)c2cc(Cl)c(N)cc2OC)CC1 |
| InChI | InChI=1S/C18H25BClN3O3/c1-26-17-9-16(21)15(20)8-14(17)18(25)22-11-12-2-5-23(6-3-12)7-4-13(24)10-19/h8-9,12H,2-7,10-11,21H2,1H3,(H,22,25) |
| InChIKey | QPELFRXGFIUHRQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|