C27H45ClN4O2 — CID 54288772
4-amino-5-chloro-N-[[1-[5-[cyclohexyl(ethyl)amino]pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide (PubChem CID 54288772) has the molecular formula C27H45ClN4O2 and a molecular weight of 493.14 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[1-[5-[cyclohexyl(ethyl)amino]pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[[1-[5-[cyclohexyl(ethyl)amino]pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 54288772 |
| Molecular Formula | C27H45ClN4O2 |
| Molecular Weight | 493.14 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | 4-amino-5-chloro-N-[[1-[5-[cyclohexyl(ethyl)amino]pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
| SMILES | CCN(CCCCCN1CCC(CNC(=O)c2cc(Cl)c(N)cc2OC)CC1)C1CCCCC1 |
| InChI | InChI=1S/C27H45ClN4O2/c1-3-32(22-10-6-4-7-11-22)15-9-5-8-14-31-16-12-21(13-17-31)20-30-27(33)23-18-24(28)25(29)19-26(23)34-2/h18-19,21-22H,3-17,20,29H2,1-2H3,(H,30,33) |
| InChIKey | RWAJXLSCVWFGEM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.14 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|