C26H43Cl2N3O3 — CID 70076286
4-amino-5-chloro-N-[[1-[5-(cyclohexylmethoxy)pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide;hydrochloride (PubChem CID 70076286) has the molecular formula C26H43Cl2N3O3 and a molecular weight of 516.55 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[1-[5-(cyclohexylmethoxy)pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-N-[[1-[5-(cyclohexylmethoxy)pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 70076286 |
| Molecular Formula | C26H43Cl2N3O3 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | 4-amino-5-chloro-N-[[1-[5-(cyclohexylmethoxy)pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide;hydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCCOCC2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C26H42ClN3O3.ClH/c1-32-25-17-24(28)23(27)16-22(25)26(31)29-18-20-10-13-30(14-11-20)12-6-3-7-15-33-19-21-8-4-2-5-9-21;/h16-17,20-21H,2-15,18-19,28H2,1H3,(H,29,31);1H |
| InChIKey | YUJVJEWJXITMNB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|