C24H41ClN4O2 — CID 54117469
4-amino-5-chloro-N-[[1-[6-(diethylamino)hexyl]piperidin-4-yl]methyl]-2-methoxybenzamide (PubChem CID 54117469) has the molecular formula C24H41ClN4O2 and a molecular weight of 453.07 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[1-[6-(diethylamino)hexyl]piperidin-4-yl]methyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[[1-[6-(diethylamino)hexyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 54117469 |
| Molecular Formula | C24H41ClN4O2 |
| Molecular Weight | 453.07 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 4-amino-5-chloro-N-[[1-[6-(diethylamino)hexyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
| SMILES | CCN(CC)CCCCCCN1CCC(CNC(=O)c2cc(Cl)c(N)cc2OC)CC1 |
| InChI | InChI=1S/C24H41ClN4O2/c1-4-28(5-2)12-8-6-7-9-13-29-14-10-19(11-15-29)18-27-24(30)20-16-21(25)22(26)17-23(20)31-3/h16-17,19H,4-15,18,26H2,1-3H3,(H,27,30) |
| InChIKey | NLILUMPMKYYMEA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.07 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|