C18H28ClN5O2S — CID 54217784
4-amino-5-chloro-2-methoxy-N-[[1-[3-(methylcarbamothioylamino)propyl]pyrrolidin-3-yl]methyl]benzamide (PubChem CID 54217784) has the molecular formula C18H28ClN5O2S and a molecular weight of 413.98 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[1-[3-(methylcarbamothioylamino)propyl]pyrrolidin-3-yl]methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[1-[3-(methylcarbamothioylamino)propyl]pyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 54217784 |
| Molecular Formula | C18H28ClN5O2S |
| Molecular Weight | 413.98 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[1-[3-(methylcarbamothioylamino)propyl]pyrrolidin-3-yl]methyl]benzamide |
| SMILES | CNC(=S)NCCCN1CCC(CNC(=O)c2cc(Cl)c(N)cc2OC)C1 |
| InChI | InChI=1S/C18H28ClN5O2S/c1-21-18(27)22-5-3-6-24-7-4-12(11-24)10-23-17(25)13-8-14(19)15(20)9-16(13)26-2/h8-9,12H,3-7,10-11,20H2,1-2H3,(H,23,25)(H2,21,22,27) |
| InChIKey | QAKIPSGFAVNASC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.98 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|