C24H37ClN4O3S — CID 87509046
4-amino-N-[1-[(1-butanethioylpiperidin-4-yl)methyl]-3-methoxypiperidin-4-yl]-5-chloro-2-methoxybenzamide (PubChem CID 87509046) has the molecular formula C24H37ClN4O3S and a molecular weight of 497.11 g/mol. Its IUPAC name is 4-amino-N-[1-[(1-butanethioylpiperidin-4-yl)methyl]-3-methoxypiperidin-4-yl]-5-chloro-2-methoxybenzamide.
| Compound Name | 4-amino-N-[1-[(1-butanethioylpiperidin-4-yl)methyl]-3-methoxypiperidin-4-yl]-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 87509046 |
| Molecular Formula | C24H37ClN4O3S |
| Molecular Weight | 497.11 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 4-amino-N-[1-[(1-butanethioylpiperidin-4-yl)methyl]-3-methoxypiperidin-4-yl]-5-chloro-2-methoxybenzamide |
| SMILES | CCCC(=S)N1CCC(CN2CCC(NC(=O)c3cc(Cl)c(N)cc3OC)C(OC)C2)CC1 |
| InChI | InChI=1S/C24H37ClN4O3S/c1-4-5-23(33)29-10-6-16(7-11-29)14-28-9-8-20(22(15-28)32-3)27-24(30)17-12-18(25)19(26)13-21(17)31-2/h12-13,16,20,22H,4-11,14-15,26H2,1-3H3,(H,27,30) |
| InChIKey | BGIXCIRXTIHGGO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.11 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|