C21H30ClN3O4 — CID 19994835
4-amino-5-chloro-2-methoxy-N-[3-methoxy-1-[(4-oxocyclohexyl)methyl]piperidin-4-yl]benzamide (PubChem CID 19994835) has the molecular formula C21H30ClN3O4 and a molecular weight of 423.94 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[3-methoxy-1-[(4-oxocyclohexyl)methyl]piperidin-4-yl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[3-methoxy-1-[(4-oxocyclohexyl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 19994835 |
| Molecular Formula | C21H30ClN3O4 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[3-methoxy-1-[(4-oxocyclohexyl)methyl]piperidin-4-yl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CC2CCC(=O)CC2)CC1OC |
| InChI | InChI=1S/C21H30ClN3O4/c1-28-19-10-17(23)16(22)9-15(19)21(27)24-18-7-8-25(12-20(18)29-2)11-13-3-5-14(26)6-4-13/h9-10,13,18,20H,3-8,11-12,23H2,1-2H3,(H,24,27) |
| InChIKey | GMEOAMSVWSYJJU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|