C25H39ClN4O3S — CID 87509170
4-amino-5-chloro-2-methoxy-N-[3-methoxy-1-[(1-pentanethioylpiperidin-4-yl)methyl]piperidin-4-yl]benzamide (PubChem CID 87509170) has the molecular formula C25H39ClN4O3S and a molecular weight of 511.13 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[3-methoxy-1-[(1-pentanethioylpiperidin-4-yl)methyl]piperidin-4-yl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[3-methoxy-1-[(1-pentanethioylpiperidin-4-yl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 87509170 |
| Molecular Formula | C25H39ClN4O3S |
| Molecular Weight | 511.13 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[3-methoxy-1-[(1-pentanethioylpiperidin-4-yl)methyl]piperidin-4-yl]benzamide |
| SMILES | CCCCC(=S)N1CCC(CN2CCC(NC(=O)c3cc(Cl)c(N)cc3OC)C(OC)C2)CC1 |
| InChI | InChI=1S/C25H39ClN4O3S/c1-4-5-6-24(34)30-11-7-17(8-12-30)15-29-10-9-21(23(16-29)33-3)28-25(31)18-13-19(26)20(27)14-22(18)32-2/h13-14,17,21,23H,4-12,15-16,27H2,1-3H3,(H,28,31) |
| InChIKey | UNTYLSFZBOUWCC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.13 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|