C26H41ClN4O3S — CID 87509278
4-amino-5-chloro-N-[1-[(1-hexanethioylpiperidin-4-yl)methyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide (PubChem CID 87509278) has the molecular formula C26H41ClN4O3S and a molecular weight of 525.16 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[1-[(1-hexanethioylpiperidin-4-yl)methyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[1-[(1-hexanethioylpiperidin-4-yl)methyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 87509278 |
| Molecular Formula | C26H41ClN4O3S |
| Molecular Weight | 525.16 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 4-amino-5-chloro-N-[1-[(1-hexanethioylpiperidin-4-yl)methyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide |
| SMILES | CCCCCC(=S)N1CCC(CN2CCC(NC(=O)c3cc(Cl)c(N)cc3OC)C(OC)C2)CC1 |
| InChI | InChI=1S/C26H41ClN4O3S/c1-4-5-6-7-25(35)31-12-8-18(9-13-31)16-30-11-10-22(24(17-30)34-3)29-26(32)19-14-20(27)21(28)15-23(19)33-2/h14-15,18,22,24H,4-13,16-17,28H2,1-3H3,(H,29,32) |
| InChIKey | XGBVCJWOBLOIPR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.16 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|