C24H37ClN4O4 — CID 68593732
4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[2-(1-propanoylpiperidin-4-yl)ethyl]piperidin-4-yl]benzamide (PubChem CID 68593732) has the molecular formula C24H37ClN4O4 and a molecular weight of 481.04 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[2-(1-propanoylpiperidin-4-yl)ethyl]piperidin-4-yl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[2-(1-propanoylpiperidin-4-yl)ethyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 68593732 |
| Molecular Formula | C24H37ClN4O4 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[2-(1-propanoylpiperidin-4-yl)ethyl]piperidin-4-yl]benzamide |
| SMILES | CCC(=O)N1CCC(CCN2CC[C@H](NC(=O)c3cc(Cl)c(N)cc3OC)[C@H](OC)C2)CC1 |
| InChI | InChI=1S/C24H37ClN4O4/c1-4-23(30)29-11-6-16(7-12-29)5-9-28-10-8-20(22(15-28)33-3)27-24(31)17-13-18(25)19(26)14-21(17)32-2/h13-14,16,20,22H,4-12,15,26H2,1-3H3,(H,27,31)/t20-,22+/m0/s1 |
| InChIKey | UCCXXACAXNDKGL-RBBKRZOGSA-N |
| XLogP | 2.79 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|