C18H27Cl2N3O5 — CID 18981915
ethyl 2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetate;hydrochloride (PubChem CID 18981915) has the molecular formula C18H27Cl2N3O5 and a molecular weight of 436.34 g/mol. Its IUPAC name is ethyl 2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetate;hydrochloride.
| Compound Name | ethyl 2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 18981915 |
| Molecular Formula | C18H27Cl2N3O5 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | ethyl 2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetate;hydrochloride |
| SMILES | CCOC(=O)CN1CCC(NC(=O)c2cc(Cl)c(N)cc2OC)C(OC)C1.Cl |
| InChI | InChI=1S/C18H26ClN3O5.ClH/c1-4-27-17(23)10-22-6-5-14(16(9-22)26-3)21-18(24)11-7-12(19)13(20)8-15(11)25-2;/h7-8,14,16H,4-6,9-10,20H2,1-3H3,(H,21,24);1H |
| InChIKey | IKFFIBTWEQUIOL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|