C22H27ClN4O5 — CID 69406086
4-amino-5-chloro-N-[1-[2-(4-hydroxyanilino)-2-oxoethyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide (PubChem CID 69406086) has the molecular formula C22H27ClN4O5 and a molecular weight of 462.93 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[1-[2-(4-hydroxyanilino)-2-oxoethyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[1-[2-(4-hydroxyanilino)-2-oxoethyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 69406086 |
| Molecular Formula | C22H27ClN4O5 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 4-amino-5-chloro-N-[1-[2-(4-hydroxyanilino)-2-oxoethyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CC(=O)Nc2ccc(O)cc2)CC1OC |
| InChI | InChI=1S/C22H27ClN4O5/c1-31-19-10-17(24)16(23)9-15(19)22(30)26-18-7-8-27(11-20(18)32-2)12-21(29)25-13-3-5-14(28)6-4-13/h3-6,9-10,18,20,28H,7-8,11-12,24H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | FJZORPLNTHYWQU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|