C30H34ClN5O7 — CID 141227437
(1-hydroxy-2-pyridin-2-ylethyl) 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]benzoate (PubChem CID 141227437) has the molecular formula C30H34ClN5O7 and a molecular weight of 612.08 g/mol. Its IUPAC name is (1-hydroxy-2-pyridin-2-ylethyl) 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]benzoate.
| Compound Name | (1-hydroxy-2-pyridin-2-ylethyl) 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 141227437 |
| Molecular Formula | C30H34ClN5O7 |
| Molecular Weight | 612.08 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | (1-hydroxy-2-pyridin-2-ylethyl) 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]benzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@@H]1CCN(CC(=O)Nc2ccc(C(=O)OC(O)Cc3ccccn3)cc2)C[C@@H]1OC |
| InChI | InChI=1S/C30H34ClN5O7/c1-41-25-15-23(32)22(31)14-21(25)29(39)35-24-10-12-36(16-26(24)42-2)17-27(37)34-19-8-6-18(7-9-19)30(40)43-28(38)13-20-5-3-4-11-33-20/h3-9,11,14-15,24,26,28,38H,10,12-13,16-17,32H2,1-2H3,(H,34,37)(H,35,39)/t24-,26+,28?/m1/s1 |
| InChIKey | LEUZAKLIOZFCNX-MAKPOSLASA-N |
| XLogP | 2.50 |
| TPSA | 165.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.08 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|