C30H39ClN6O8 — CID 141227440
[1-hydroxy-2-oxo-2-(piperidin-4-ylamino)ethyl] 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]benzoate (PubChem CID 141227440) has the molecular formula C30H39ClN6O8 and a molecular weight of 647.13 g/mol. Its IUPAC name is [1-hydroxy-2-oxo-2-(piperidin-4-ylamino)ethyl] 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]benzoate.
| Compound Name | [1-hydroxy-2-oxo-2-(piperidin-4-ylamino)ethyl] 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 141227440 |
| Molecular Formula | C30H39ClN6O8 |
| Molecular Weight | 647.13 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | [1-hydroxy-2-oxo-2-(piperidin-4-ylamino)ethyl] 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]benzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@@H]1CCN(CC(=O)Nc2ccc(C(=O)OC(O)C(=O)NC3CCNCC3)cc2)C[C@@H]1OC |
| InChI | InChI=1S/C30H39ClN6O8/c1-43-24-14-22(32)21(31)13-20(24)27(39)36-23-9-12-37(15-25(23)44-2)16-26(38)34-18-5-3-17(4-6-18)29(41)45-30(42)28(40)35-19-7-10-33-11-8-19/h3-6,13-14,19,23,25,30,33,42H,7-12,15-16,32H2,1-2H3,(H,34,38)(H,35,40)(H,36,39)/t23-,25+,30?/m1/s1 |
| InChIKey | GPIRKJSRLFXODV-CGYACHGYSA-N |
| XLogP | 0.73 |
| TPSA | 193.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.13 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|