C21H31ClN4O5 — CID 19994885
2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethyl pyrrolidine-1-carboxylate (PubChem CID 19994885) has the molecular formula C21H31ClN4O5 and a molecular weight of 454.96 g/mol. Its IUPAC name is 2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethyl pyrrolidine-1-carboxylate.
| Compound Name | 2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19994885 |
| Molecular Formula | C21H31ClN4O5 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethyl pyrrolidine-1-carboxylate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CCOC(=O)N2CCCC2)CC1OC |
| InChI | InChI=1S/C21H31ClN4O5/c1-29-18-12-16(23)15(22)11-14(18)20(27)24-17-5-8-25(13-19(17)30-2)9-10-31-21(28)26-6-3-4-7-26/h11-12,17,19H,3-10,13,23H2,1-2H3,(H,24,27) |
| InChIKey | YKLGWISYRHHOTE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|