C20H31ClN4O5 — CID 172761446
4-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl N-methylcarbamate (PubChem CID 172761446) has the molecular formula C20H31ClN4O5 and a molecular weight of 442.94 g/mol. Its IUPAC name is 4-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl N-methylcarbamate.
| Compound Name | 4-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl N-methylcarbamate |
|---|---|
| PubChem CID | 172761446 |
| Molecular Formula | C20H31ClN4O5 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl N-methylcarbamate |
| SMILES | CNC(=O)OCCCCN1CCC(NC(=O)c2cc(Cl)c(N)cc2OC)C(OC)C1 |
| InChI | InChI=1S/C20H31ClN4O5/c1-23-20(27)30-9-5-4-7-25-8-6-16(18(12-25)29-3)24-19(26)13-10-14(21)15(22)11-17(13)28-2/h10-11,16,18H,4-9,12,22H2,1-3H3,(H,23,27)(H,24,26) |
| InChIKey | LSXMKEBNCMPXSY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|