C33H54ClN5O6 — CID 157040521
8-[4-[6-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]hexanoylamino]piperidin-1-yl]octanoic acid (PubChem CID 157040521) has the molecular formula C33H54ClN5O6 and a molecular weight of 652.28 g/mol. Its IUPAC name is 8-[4-[6-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]hexanoylamino]piperidin-1-yl]octanoic acid.
| Compound Name | 8-[4-[6-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]hexanoylamino]piperidin-1-yl]octanoic acid |
|---|---|
| PubChem CID | 157040521 |
| Molecular Formula | C33H54ClN5O6 |
| Molecular Weight | 652.28 g/mol |
| Exact Mass | 651.38 |
| IUPAC Name | 8-[4-[6-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]hexanoylamino]piperidin-1-yl]octanoic acid |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@@H]1CCN(CCCCCC(=O)NC2CCN(CCCCCCCC(=O)O)CC2)C[C@@H]1OC |
| InChI | InChI=1S/C33H54ClN5O6/c1-44-29-22-27(35)26(34)21-25(29)33(43)37-28-15-20-39(23-30(28)45-2)17-10-6-7-11-31(40)36-24-13-18-38(19-14-24)16-9-5-3-4-8-12-32(41)42/h21-22,24,28,30H,3-20,23,35H2,1-2H3,(H,36,40)(H,37,43)(H,41,42)/t28-,30+/m1/s1 |
| InChIKey | ALNZNXFEPZPCFQ-DGPALRBDSA-N |
| XLogP | 4.32 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.28 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|