C20H31ClN4O5 — CID 70047365
4-[(3R,4S)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl-methylcarbamic acid (PubChem CID 70047365) has the molecular formula C20H31ClN4O5 and a molecular weight of 442.94 g/mol. Its IUPAC name is 4-[(3R,4S)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl-methylcarbamic acid.
| Compound Name | 4-[(3R,4S)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl-methylcarbamic acid |
|---|---|
| PubChem CID | 70047365 |
| Molecular Formula | C20H31ClN4O5 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-[(3R,4S)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl-methylcarbamic acid |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@H]1CCN(CCCCN(C)C(=O)O)C[C@H]1OC |
| InChI | InChI=1S/C20H31ClN4O5/c1-24(20(27)28)7-4-5-8-25-9-6-16(18(12-25)30-3)23-19(26)13-10-14(21)15(22)11-17(13)29-2/h10-11,16,18H,4-9,12,22H2,1-3H3,(H,23,26)(H,27,28)/t16-,18+/m0/s1 |
| InChIKey | NWAQEBZLHMOCBY-FUHWJXTLSA-N |
| XLogP | 2.14 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|