C22H31ClN6O3 — CID 14855009
4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[4-(pyrimidin-2-ylamino)butyl]piperidin-4-yl]benzamide (PubChem CID 14855009) has the molecular formula C22H31ClN6O3 and a molecular weight of 462.98 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[4-(pyrimidin-2-ylamino)butyl]piperidin-4-yl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[4-(pyrimidin-2-ylamino)butyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 14855009 |
| Molecular Formula | C22H31ClN6O3 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[4-(pyrimidin-2-ylamino)butyl]piperidin-4-yl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@H]1CCN(CCCCNc2ncccn2)C[C@H]1OC |
| InChI | InChI=1S/C22H31ClN6O3/c1-31-19-13-17(24)16(23)12-15(19)21(30)28-18-6-11-29(14-20(18)32-2)10-4-3-7-25-22-26-8-5-9-27-22/h5,8-9,12-13,18,20H,3-4,6-7,10-11,14,24H2,1-2H3,(H,28,30)(H,25,26,27)/t18-,20+/m0/s1 |
| InChIKey | AYNPKZXATVXRQK-AZUAARDMSA-N |
| XLogP | 2.43 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|