C24H32Cl2F3N5O4 — CID 19888435
4-amino-5-chloro-N-[1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide;hydrate (PubChem CID 19888435) has the molecular formula C24H32Cl2F3N5O4 and a molecular weight of 582.45 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide;hydrate.
| Compound Name | 4-amino-5-chloro-N-[1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide;hydrate |
|---|---|
| PubChem CID | 19888435 |
| Molecular Formula | C24H32Cl2F3N5O4 |
| Molecular Weight | 582.45 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | 4-amino-5-chloro-N-[1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]butyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide;hydrate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CCCCNc2ncc(C(F)(F)F)cc2Cl)CC1OC.O |
| InChI | InChI=1S/C24H30Cl2F3N5O3.H2O/c1-36-20-11-18(30)16(25)10-15(20)23(35)33-19-5-8-34(13-21(19)37-2)7-4-3-6-31-22-17(26)9-14(12-32-22)24(27,28)29;/h9-12,19,21H,3-8,13,30H2,1-2H3,(H,31,32)(H,33,35);1H2 |
| InChIKey | JPQFLSDYIAASJW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|