C46H60Cl2N12O7 — CID 88606688
bis(4-amino-5-chloro-N-[1-[3-[(3-cyano-2-pyridinyl)amino]propyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide);hydrate (PubChem CID 88606688) has the molecular formula C46H60Cl2N12O7 and a molecular weight of 963.97 g/mol. Its IUPAC name is bis(4-amino-5-chloro-N-[1-[3-[(3-cyano-2-pyridinyl)amino]propyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide);hydrate.
| Compound Name | bis(4-amino-5-chloro-N-[1-[3-[(3-cyano-2-pyridinyl)amino]propyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide);hydrate |
|---|---|
| PubChem CID | 88606688 |
| Molecular Formula | C46H60Cl2N12O7 |
| Molecular Weight | 963.97 g/mol |
| Exact Mass | 962.41 |
| IUPAC Name | bis(4-amino-5-chloro-N-[1-[3-[(3-cyano-2-pyridinyl)amino]propyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide);hydrate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CCCNc2ncccc2C#N)CC1OC.COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CCCNc2ncccc2C#N)CC1OC.O |
| InChI | InChI=1S/2C23H29ClN6O3.H2O/c2*1-32-20-12-18(26)17(24)11-16(20)23(31)29-19-6-10-30(14-21(19)33-2)9-4-8-28-22-15(13-25)5-3-7-27-22;/h2*3,5,7,11-12,19,21H,4,6,8-10,14,26H2,1-2H3,(H,27,28)(H,29,31);1H2 |
| InChIKey | FSPLEJJBSGTPMP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 282.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.97 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|