C17H27ClN4O6 — CID 70048632
2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylcarbamic acid;hydrate (PubChem CID 70048632) has the molecular formula C17H27ClN4O6 and a molecular weight of 418.88 g/mol. Its IUPAC name is 2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylcarbamic acid;hydrate.
| Compound Name | 2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylcarbamic acid;hydrate |
|---|---|
| PubChem CID | 70048632 |
| Molecular Formula | C17H27ClN4O6 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylcarbamic acid;hydrate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CCNC(=O)O)CC1OC.O |
| InChI | InChI=1S/C17H25ClN4O5.H2O/c1-26-14-8-12(19)11(18)7-10(14)16(23)21-13-3-5-22(9-15(13)27-2)6-4-20-17(24)25;/h7-8,13,15,20H,3-6,9,19H2,1-2H3,(H,21,23)(H,24,25);1H2 |
| InChIKey | NFSOLPRHIKNQAS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 157.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|