C19H29ClN4O5 — CID 19994858
ethyl N-[2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethyl]carbamate (PubChem CID 19994858) has the molecular formula C19H29ClN4O5 and a molecular weight of 428.92 g/mol. Its IUPAC name is ethyl N-[2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethyl]carbamate.
| Compound Name | ethyl N-[2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 19994858 |
| Molecular Formula | C19H29ClN4O5 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | ethyl N-[2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethyl]carbamate |
| SMILES | CCOC(=O)NCCN1CCC(NC(=O)c2cc(Cl)c(N)cc2OC)C(OC)C1 |
| InChI | InChI=1S/C19H29ClN4O5/c1-4-29-19(26)22-6-8-24-7-5-15(17(11-24)28-3)23-18(25)12-9-13(20)14(21)10-16(12)27-2/h9-10,15,17H,4-8,11,21H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | IQQUXOXSWNXXRB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|