C22H33ClN4O4 — CID 67922911
4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-(4-oxo-4-pyrrolidin-1-ylbutyl)piperidin-4-yl]benzamide (PubChem CID 67922911) has the molecular formula C22H33ClN4O4 and a molecular weight of 452.98 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-(4-oxo-4-pyrrolidin-1-ylbutyl)piperidin-4-yl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-(4-oxo-4-pyrrolidin-1-ylbutyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 67922911 |
| Molecular Formula | C22H33ClN4O4 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-(4-oxo-4-pyrrolidin-1-ylbutyl)piperidin-4-yl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@H]1CCN(CCCC(=O)N2CCCC2)C[C@H]1OC |
| InChI | InChI=1S/C22H33ClN4O4/c1-30-19-13-17(24)16(23)12-15(19)22(29)25-18-7-11-26(14-20(18)31-2)8-5-6-21(28)27-9-3-4-10-27/h12-13,18,20H,3-11,14,24H2,1-2H3,(H,25,29)/t18-,20+/m0/s1 |
| InChIKey | CLCALZVOCGURBC-AZUAARDMSA-N |
| XLogP | 2.15 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|