C24H40ClN5O5 — CID 67922664
N-[4-[(3R,4S)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl]-N-methylpyrrolidine-1-carboxamide;hydrate (PubChem CID 67922664) has the molecular formula C24H40ClN5O5 and a molecular weight of 514.07 g/mol. Its IUPAC name is N-[4-[(3R,4S)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl]-N-methylpyrrolidine-1-carboxamide;hydrate.
| Compound Name | N-[4-[(3R,4S)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl]-N-methylpyrrolidine-1-carboxamide;hydrate |
|---|---|
| PubChem CID | 67922664 |
| Molecular Formula | C24H40ClN5O5 |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | N-[4-[(3R,4S)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]butyl]-N-methylpyrrolidine-1-carboxamide;hydrate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@H]1CCN(CCCCN(C)C(=O)N2CCCC2)C[C@H]1OC.O |
| InChI | InChI=1S/C24H38ClN5O4.H2O/c1-28(24(32)30-11-6-7-12-30)9-4-5-10-29-13-8-20(22(16-29)34-3)27-23(31)17-14-18(25)19(26)15-21(17)33-2;/h14-15,20,22H,4-13,16,26H2,1-3H3,(H,27,31);1H2/t20-,22+;/m0./s1 |
| InChIKey | ZYRZFXNDOHIYHO-IKGOIYPNSA-N |
| XLogP | 1.85 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|