C26H35ClN4O5 — CID 11376325
ethyl 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]benzoate (PubChem CID 11376325) has the molecular formula C26H35ClN4O5 and a molecular weight of 519.04 g/mol. Its IUPAC name is ethyl 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]benzoate.
| Compound Name | ethyl 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]benzoate |
|---|---|
| PubChem CID | 11376325 |
| Molecular Formula | C26H35ClN4O5 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | ethyl 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CNCCN2CC[C@@H](NC(=O)c3cc(Cl)c(N)cc3OC)[C@@H](OC)C2)cc1 |
| InChI | InChI=1S/C26H35ClN4O5/c1-4-36-26(33)18-7-5-17(6-8-18)15-29-10-12-31-11-9-22(24(16-31)35-3)30-25(32)19-13-20(27)21(28)14-23(19)34-2/h5-8,13-14,22,24,29H,4,9-12,15-16,28H2,1-3H3,(H,30,32)/t22-,24+/m1/s1 |
| InChIKey | JWPHDQPWKAYMAI-VWNXMTODSA-N |
| XLogP | 2.72 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|