C29H40ClN5O5 — CID 24781262
piperidin-4-yl 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]benzoate (PubChem CID 24781262) has the molecular formula C29H40ClN5O5 and a molecular weight of 574.12 g/mol. Its IUPAC name is piperidin-4-yl 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]benzoate.
| Compound Name | piperidin-4-yl 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]benzoate |
|---|---|
| PubChem CID | 24781262 |
| Molecular Formula | C29H40ClN5O5 |
| Molecular Weight | 574.12 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | piperidin-4-yl 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]benzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@@H]1CCN(CCNCc2ccc(C(=O)OC3CCNCC3)cc2)C[C@@H]1OC |
| InChI | InChI=1S/C29H40ClN5O5/c1-38-26-16-24(31)23(30)15-22(26)28(36)34-25-9-13-35(18-27(25)39-2)14-12-33-17-19-3-5-20(6-4-19)29(37)40-21-7-10-32-11-8-21/h3-6,15-16,21,25,27,32-33H,7-14,17-18,31H2,1-2H3,(H,34,36)/t25-,27+/m1/s1 |
| InChIKey | XKPKYMXXHGDIET-VPUSJEBWSA-N |
| XLogP | 2.45 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.12 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|