C28H40Cl2N4O5 — CID 142757081
4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]-2,3-diethylbenzoic acid;hydrochloride (PubChem CID 142757081) has the molecular formula C28H40Cl2N4O5 and a molecular weight of 583.56 g/mol. Its IUPAC name is 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]-2,3-diethylbenzoic acid;hydrochloride.
| Compound Name | 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]-2,3-diethylbenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 142757081 |
| Molecular Formula | C28H40Cl2N4O5 |
| Molecular Weight | 583.56 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | 4-[[2-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]ethylamino]methyl]-2,3-diethylbenzoic acid;hydrochloride |
| SMILES | CCc1c(CNCCN2CCC(NC(=O)c3cc(Cl)c(N)cc3OC)[C@@H](OC)C2)ccc(C(=O)O)c1CC.Cl |
| InChI | InChI=1S/C28H39ClN4O5.ClH/c1-5-18-17(7-8-20(28(35)36)19(18)6-2)15-31-10-12-33-11-9-24(26(16-33)38-4)32-27(34)21-13-22(29)23(30)14-25(21)37-3;/h7-8,13-14,24,26,31H,5-6,9-12,15-16,30H2,1-4H3,(H,32,34)(H,35,36);1H/t24?,26-;/m0./s1 |
| InChIKey | WSIVELXUSMJFFD-YYDIRSKFSA-N |
| XLogP | 3.78 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|