C20H30ClN3O4 — CID 18981928
6-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methylpiperidin-1-yl]hexanoic acid (PubChem CID 18981928) has the molecular formula C20H30ClN3O4 and a molecular weight of 411.93 g/mol. Its IUPAC name is 6-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methylpiperidin-1-yl]hexanoic acid.
| Compound Name | 6-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methylpiperidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 18981928 |
| Molecular Formula | C20H30ClN3O4 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 6-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methylpiperidin-1-yl]hexanoic acid |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CCCCCC(=O)O)CC1C |
| InChI | InChI=1S/C20H30ClN3O4/c1-13-12-24(8-5-3-4-6-19(25)26)9-7-17(13)23-20(27)14-10-15(21)16(22)11-18(14)28-2/h10-11,13,17H,3-9,12,22H2,1-2H3,(H,23,27)(H,25,26) |
| InChIKey | WWSKWTJWTDCOII-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|