C24H29ClN4O6 — CID 91063900
2-[4-[[2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]phenyl]acetic acid (PubChem CID 91063900) has the molecular formula C24H29ClN4O6 and a molecular weight of 504.97 g/mol. Its IUPAC name is 2-[4-[[2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 91063900 |
| Molecular Formula | C24H29ClN4O6 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 2-[4-[[2-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]acetyl]amino]phenyl]acetic acid |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CC(=O)Nc2ccc(CC(=O)O)cc2)CC1OC |
| InChI | InChI=1S/C24H29ClN4O6/c1-34-20-11-18(26)17(25)10-16(20)24(33)28-19-7-8-29(12-21(19)35-2)13-22(30)27-15-5-3-14(4-6-15)9-23(31)32/h3-6,10-11,19,21H,7-9,12-13,26H2,1-2H3,(H,27,30)(H,28,33)(H,31,32) |
| InChIKey | MXKVBGFGZOREGO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|