C22H34ClN3O5 — CID 157040616
methyl 6-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]-4-methylhexanoate (PubChem CID 157040616) has the molecular formula C22H34ClN3O5 and a molecular weight of 455.98 g/mol. Its IUPAC name is methyl 6-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]-4-methylhexanoate.
| Compound Name | methyl 6-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]-4-methylhexanoate |
|---|---|
| PubChem CID | 157040616 |
| Molecular Formula | C22H34ClN3O5 |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | methyl 6-[(3S,4R)-4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-3-methoxypiperidin-1-yl]-4-methylhexanoate |
| SMILES | COC(=O)CCC(C)CCN1CC[C@@H](NC(=O)c2cc(Cl)c(N)cc2OC)[C@@H](OC)C1 |
| InChI | InChI=1S/C22H34ClN3O5/c1-14(5-6-21(27)31-4)7-9-26-10-8-18(20(13-26)30-3)25-22(28)15-11-16(23)17(24)12-19(15)29-2/h11-12,14,18,20H,5-10,13,24H2,1-4H3,(H,25,28)/t14?,18-,20+/m1/s1 |
| InChIKey | IDBQMIGLBHRGOM-UCPOHXDKSA-N |
| XLogP | 2.73 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|