C26H41ClN4O3S — CID 87509749
4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[[1-(4-methylpentanethioyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide (PubChem CID 87509749) has the molecular formula C26H41ClN4O3S and a molecular weight of 525.16 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[[1-(4-methylpentanethioyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[[1-(4-methylpentanethioyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 87509749 |
| Molecular Formula | C26H41ClN4O3S |
| Molecular Weight | 525.16 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[(3R,4S)-3-methoxy-1-[[1-(4-methylpentanethioyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@H]1CCN(CC2CCN(C(=S)CCC(C)C)CC2)C[C@H]1OC |
| InChI | InChI=1S/C26H41ClN4O3S/c1-17(2)5-6-25(35)31-11-7-18(8-12-31)15-30-10-9-22(24(16-30)34-4)29-26(32)19-13-20(27)21(28)14-23(19)33-3/h13-14,17-18,22,24H,5-12,15-16,28H2,1-4H3,(H,29,32)/t22-,24+/m0/s1 |
| InChIKey | YDEXUTQFRWWIIG-LADGPHEKSA-N |
| XLogP | 4.23 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.16 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|