C21H28ClN3O2 — CID 70607258
5-chloro-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxy-4-(methylamino)benzamide (PubChem CID 70607258) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 5-chloro-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxy-4-(methylamino)benzamide.
| Compound Name | 5-chloro-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxy-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 70607258 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 5-chloro-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxy-4-(methylamino)benzamide |
| SMILES | CNc1cc(OC)c(C(=O)NC2CCN(CC3=CCC=CC3)CC2)cc1Cl |
| InChI | InChI=1S/C21H28ClN3O2/c1-23-19-13-20(27-2)17(12-18(19)22)21(26)24-16-8-10-25(11-9-16)14-15-6-4-3-5-7-15/h3-4,7,12-13,16,23H,5-6,8-11,14H2,1-2H3,(H,24,26) |
| InChIKey | BEIFNSCIPDXFLX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|