C22H32ClN3O6 — CID 139814241
2-methoxyethyl 4-[4-[(4-acetamido-5-chloro-2-methoxybenzoyl)amino]piperidin-1-yl]butanoate (PubChem CID 139814241) has the molecular formula C22H32ClN3O6 and a molecular weight of 469.97 g/mol. Its IUPAC name is 2-methoxyethyl 4-[4-[(4-acetamido-5-chloro-2-methoxybenzoyl)amino]piperidin-1-yl]butanoate.
| Compound Name | 2-methoxyethyl 4-[4-[(4-acetamido-5-chloro-2-methoxybenzoyl)amino]piperidin-1-yl]butanoate |
|---|---|
| PubChem CID | 139814241 |
| Molecular Formula | C22H32ClN3O6 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-methoxyethyl 4-[4-[(4-acetamido-5-chloro-2-methoxybenzoyl)amino]piperidin-1-yl]butanoate |
| SMILES | COCCOC(=O)CCCN1CCC(NC(=O)c2cc(Cl)c(NC(C)=O)cc2OC)CC1 |
| InChI | InChI=1S/C22H32ClN3O6/c1-15(27)24-19-14-20(31-3)17(13-18(19)23)22(29)25-16-6-9-26(10-7-16)8-4-5-21(28)32-12-11-30-2/h13-14,16H,4-12H2,1-3H3,(H,24,27)(H,25,29) |
| InChIKey | GWDAWMIEHICREZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|