C29H40ClN3O9 — CID 18981888
(E)-but-2-enedioic acid;ethyl 5-[3-[(4-acetamido-5-chloro-2-methoxybenzoyl)amino]-9-azabicyclo[3.3.1]nonan-9-yl]pentanoate (PubChem CID 18981888) has the molecular formula C29H40ClN3O9 and a molecular weight of 610.10 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;ethyl 5-[3-[(4-acetamido-5-chloro-2-methoxybenzoyl)amino]-9-azabicyclo[3.3.1]nonan-9-yl]pentanoate.
| Compound Name | (E)-but-2-enedioic acid;ethyl 5-[3-[(4-acetamido-5-chloro-2-methoxybenzoyl)amino]-9-azabicyclo[3.3.1]nonan-9-yl]pentanoate |
|---|---|
| PubChem CID | 18981888 |
| Molecular Formula | C29H40ClN3O9 |
| Molecular Weight | 610.10 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | (E)-but-2-enedioic acid;ethyl 5-[3-[(4-acetamido-5-chloro-2-methoxybenzoyl)amino]-9-azabicyclo[3.3.1]nonan-9-yl]pentanoate |
| SMILES | CCOC(=O)CCCCN1C2CCCC1CC(NC(=O)c1cc(Cl)c(NC(C)=O)cc1OC)C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C25H36ClN3O5.C4H4O4/c1-4-34-24(31)10-5-6-11-29-18-8-7-9-19(29)13-17(12-18)28-25(32)20-14-21(26)22(27-16(2)30)15-23(20)33-3;5-3(6)1-2-4(7)8/h14-15,17-19H,4-13H2,1-3H3,(H,27,30)(H,28,32);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | VXAYRQJJDGVEQB-WLHGVMLRSA-N |
| XLogP | 3.87 |
| TPSA | 171.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.10 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|