C23H34ClN3O4 — CID 18981868
ethyl 4-[3-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-9-azabicyclo[3.3.1]nonan-9-yl]butanoate (PubChem CID 18981868) has the molecular formula C23H34ClN3O4 and a molecular weight of 452.00 g/mol. Its IUPAC name is ethyl 4-[3-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-9-azabicyclo[3.3.1]nonan-9-yl]butanoate.
| Compound Name | ethyl 4-[3-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-9-azabicyclo[3.3.1]nonan-9-yl]butanoate |
|---|---|
| PubChem CID | 18981868 |
| Molecular Formula | C23H34ClN3O4 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | ethyl 4-[3-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-9-azabicyclo[3.3.1]nonan-9-yl]butanoate |
| SMILES | CCOC(=O)CCCN1C2CCCC1CC(CNC(=O)c1cc(Cl)c(N)cc1OC)C2 |
| InChI | InChI=1S/C23H34ClN3O4/c1-3-31-22(28)8-5-9-27-16-6-4-7-17(27)11-15(10-16)14-26-23(29)18-12-19(24)20(25)13-21(18)30-2/h12-13,15-17H,3-11,14,25H2,1-2H3,(H,26,29) |
| InChIKey | MUWZWUUETQFFJS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|