C20H26ClN5O2 — CID 44522222
4-amino-5-chloro-N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-2-methoxybenzamide (PubChem CID 44522222) has the molecular formula C20H26ClN5O2 and a molecular weight of 403.91 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 44522222 |
| Molecular Formula | C20H26ClN5O2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 4-amino-5-chloro-N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(c2nc(C)cc(C)n2)CC1 |
| InChI | InChI=1S/C20H26ClN5O2/c1-12-8-13(2)25-20(24-12)26-6-4-14(5-7-26)11-23-19(27)15-9-16(21)17(22)10-18(15)28-3/h8-10,14H,4-7,11,22H2,1-3H3,(H,23,27) |
| InChIKey | SDYBCXRHDHYGFM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|