C22H26ClN3O3 — CID 174744727
4-amino-5-chloro-N-[[1-[2-(2-hydroxyphenyl)ethenyl]piperidin-4-yl]methyl]-2-methoxybenzamide (PubChem CID 174744727) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[1-[2-(2-hydroxyphenyl)ethenyl]piperidin-4-yl]methyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[[1-[2-(2-hydroxyphenyl)ethenyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 174744727 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-amino-5-chloro-N-[[1-[2-(2-hydroxyphenyl)ethenyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(C=Cc2ccccc2O)CC1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-29-21-13-19(24)18(23)12-17(21)22(28)25-14-15-6-9-26(10-7-15)11-8-16-4-2-3-5-20(16)27/h2-5,8,11-13,15,27H,6-7,9-10,14,24H2,1H3,(H,25,28) |
| InChIKey | NFTKWWJWAVAQRS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|