C16H24Cl3N3O2 — CID 18643698
4-amino-5-chloro-N-[[(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]-2-methoxybenzamide;dihydrochloride (PubChem CID 18643698) has the molecular formula C16H24Cl3N3O2 and a molecular weight of 396.75 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]-2-methoxybenzamide;dihydrochloride.
| Compound Name | 4-amino-5-chloro-N-[[(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]-2-methoxybenzamide;dihydrochloride |
|---|---|
| PubChem CID | 18643698 |
| Molecular Formula | C16H24Cl3N3O2 |
| Molecular Weight | 396.75 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-amino-5-chloro-N-[[(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl]-2-methoxybenzamide;dihydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC[C@H]1CCN2CCC[C@@H]12.Cl.Cl |
| InChI | InChI=1S/C16H22ClN3O2.2ClH/c1-22-15-8-13(18)12(17)7-11(15)16(21)19-9-10-4-6-20-5-2-3-14(10)20;;/h7-8,10,14H,2-6,9,18H2,1H3,(H,19,21);2*1H/t10-,14+;;/m1../s1 |
| InChIKey | SSRCRFRCJWMWER-ROXZIJFUSA-N |
| XLogP | 2.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.75 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|