C15H24Cl3N3O3 — CID 70075847
4-amino-5-chloro-2-methoxy-N-[[(3S,4R)-3-methoxypiperidin-4-yl]methyl]benzamide;dihydrochloride (PubChem CID 70075847) has the molecular formula C15H24Cl3N3O3 and a molecular weight of 400.73 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[(3S,4R)-3-methoxypiperidin-4-yl]methyl]benzamide;dihydrochloride.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[(3S,4R)-3-methoxypiperidin-4-yl]methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 70075847 |
| Molecular Formula | C15H24Cl3N3O3 |
| Molecular Weight | 400.73 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[(3S,4R)-3-methoxypiperidin-4-yl]methyl]benzamide;dihydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC[C@H]1CCNC[C@H]1OC.Cl.Cl |
| InChI | InChI=1S/C15H22ClN3O3.2ClH/c1-21-13-6-12(17)11(16)5-10(13)15(20)19-7-9-3-4-18-8-14(9)22-2;;/h5-6,9,14,18H,3-4,7-8,17H2,1-2H3,(H,19,20);2*1H/t9-,14-;;/m1../s1 |
| InChIKey | OLLJMFVHWXNCRX-YBFSGDKESA-N |
| XLogP | 2.13 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|