C21H26ClN3O2 — CID 10407929
4-amino-N-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]methyl]-5-chloro-2-methoxybenzamide (PubChem CID 10407929) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is 4-amino-N-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]methyl]-5-chloro-2-methoxybenzamide.
| Compound Name | 4-amino-N-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]methyl]-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 10407929 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-amino-N-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]methyl]-5-chloro-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC[C@@H]1CN(Cc2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C21H26ClN3O2/c1-14-11-25(12-15-6-4-3-5-7-15)13-16(14)10-24-21(26)17-8-18(22)19(23)9-20(17)27-2/h3-9,14,16H,10-13,23H2,1-2H3,(H,24,26)/t14-,16+/m0/s1 |
| InChIKey | ADUNLFQRTVJTRO-GOEBONIOSA-N |
| XLogP | 3.43 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|