C21H23ClF3N3O3 — CID 3087008
4-amino-5-chloro-2-methoxy-N-[[4-[[3-(trifluoromethyl)phenyl]methyl]morpholin-2-yl]methyl]benzamide (PubChem CID 3087008) has the molecular formula C21H23ClF3N3O3 and a molecular weight of 457.88 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[4-[[3-(trifluoromethyl)phenyl]methyl]morpholin-2-yl]methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[4-[[3-(trifluoromethyl)phenyl]methyl]morpholin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 3087008 |
| Molecular Formula | C21H23ClF3N3O3 |
| Molecular Weight | 457.88 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[4-[[3-(trifluoromethyl)phenyl]methyl]morpholin-2-yl]methyl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CN(Cc2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C21H23ClF3N3O3/c1-30-19-9-18(26)17(22)8-16(19)20(29)27-10-15-12-28(5-6-31-15)11-13-3-2-4-14(7-13)21(23,24)25/h2-4,7-9,15H,5-6,10-12,26H2,1H3,(H,27,29) |
| InChIKey | YMDDXYWRDJZWSF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|