C20H28BClN4O4 — CID 59510467
CID 59510467 (PubChem CID 59510467) has the molecular formula C20H28BClN4O4 and a molecular weight of 434.73 g/mol.
| Compound Name | CID 59510467 |
|---|---|
| PubChem CID | 59510467 |
| Molecular Formula | C20H28BClN4O4 |
| Molecular Weight | 434.73 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCC(CN2CCO[C@@H](CNC(=O)c3cc(Cl)c(N)cc3OC)C2)CC1 |
| InChI | InChI=1S/C20H28BClN4O4/c1-29-18-9-17(23)16(22)8-15(18)19(27)24-10-14-12-25(6-7-30-14)11-13-2-4-26(5-3-13)20(21)28/h8-9,13-14H,2-7,10-12,23H2,1H3,(H,24,27)/t14-/m0/s1 |
| InChIKey | TVWNTUFIRRNMHD-AWEZNQCLSA-N |
| XLogP | 1.36 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.73 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|