C20H31ClN4O5S — CID 67055744
4-amino-5-chloro-2-methoxy-N-[[(2S)-4-[(1-methylsulfonylpiperidin-4-yl)methyl]morpholin-2-yl]methyl]benzamide (PubChem CID 67055744) has the molecular formula C20H31ClN4O5S and a molecular weight of 475.01 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[(2S)-4-[(1-methylsulfonylpiperidin-4-yl)methyl]morpholin-2-yl]methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[(2S)-4-[(1-methylsulfonylpiperidin-4-yl)methyl]morpholin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 67055744 |
| Molecular Formula | C20H31ClN4O5S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[(2S)-4-[(1-methylsulfonylpiperidin-4-yl)methyl]morpholin-2-yl]methyl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC[C@H]1CN(CC2CCN(S(C)(=O)=O)CC2)CCO1 |
| InChI | InChI=1S/C20H31ClN4O5S/c1-29-19-10-18(22)17(21)9-16(19)20(26)23-11-15-13-24(7-8-30-15)12-14-3-5-25(6-4-14)31(2,27)28/h9-10,14-15H,3-8,11-13,22H2,1-2H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | HYUUGAZRJIWPBF-HNNXBMFYSA-N |
| XLogP | 1.03 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|