C16H22ClN3O5 — CID 14877396
ethyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]morpholine-4-carboxylate (PubChem CID 14877396) has the molecular formula C16H22ClN3O5 and a molecular weight of 371.82 g/mol. Its IUPAC name is ethyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]morpholine-4-carboxylate.
| Compound Name | ethyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 14877396 |
| Molecular Formula | C16H22ClN3O5 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | ethyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]morpholine-4-carboxylate |
| SMILES | CCOC(=O)N1CCOC(CNC(=O)c2cc(Cl)c(N)cc2OC)C1 |
| InChI | InChI=1S/C16H22ClN3O5/c1-3-24-16(22)20-4-5-25-10(9-20)8-19-15(21)11-6-12(17)13(18)7-14(11)23-2/h6-7,10H,3-5,8-9,18H2,1-2H3,(H,19,21) |
| InChIKey | PUEKXXRSLTWHEW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|