C19H28ClN3O5 — CID 59510500
tert-butyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-1,4-oxazepane-4-carboxylate (PubChem CID 59510500) has the molecular formula C19H28ClN3O5 and a molecular weight of 413.90 g/mol. Its IUPAC name is tert-butyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 59510500 |
| Molecular Formula | C19H28ClN3O5 |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | tert-butyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-1,4-oxazepane-4-carboxylate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CN(C(=O)OC(C)(C)C)CCCO1 |
| InChI | InChI=1S/C19H28ClN3O5/c1-19(2,3)28-18(25)23-6-5-7-27-12(11-23)10-22-17(24)13-8-14(20)15(21)9-16(13)26-4/h8-9,12H,5-7,10-11,21H2,1-4H3,(H,22,24) |
| InChIKey | RBGAEUARIYJTOE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|