C16H24ClN3O3 — CID 119830234
4-amino-5-chloro-2-methoxy-N-(2-methyl-2-morpholin-4-ylpropyl)benzamide (PubChem CID 119830234) has the molecular formula C16H24ClN3O3 and a molecular weight of 341.84 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-(2-methyl-2-morpholin-4-ylpropyl)benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-(2-methyl-2-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 119830234 |
| Molecular Formula | C16H24ClN3O3 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-(2-methyl-2-morpholin-4-ylpropyl)benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C16H24ClN3O3/c1-16(2,20-4-6-23-7-5-20)10-19-15(21)11-8-12(17)13(18)9-14(11)22-3/h8-9H,4-7,10,18H2,1-3H3,(H,19,21) |
| InChIKey | YYHGHDKYXIDDIE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|